| Name | 4,4'-Dinitrodiphenyl disulfide |
| Synonyms | 4-NITROPHENYL SULFIDE P-NITROPHENYLDISULFIDE 4-NITROPHENYL DISULFIDE Di(4-nitrophenyl) disulfide DI(4-NITROPHENYL) DISULFIDE BIS(4-NITROPHENYL) DISULFIDE Bis(4-nitrophenyl) disulfide BIS(P-NITROPHENYL) DISULFIDE 4,4'-Dinitrodiphenyl disulfide P,P'-DINITRODIPHENYL DISULFIDE 4,4-Dinitro diphenyl disulfide 4,4'-DINITRO DIPHENYL DISULFIDE 1,1'-disulfanediylbis(4-nitrobenzene) |
| CAS | 100-32-3 |
| EINECS | 202-840-5 |
| InChI | InChI=1/C12H8N2O4S2/c15-13(16)9-1-5-11(6-2-9)19-20-12-7-3-10(4-8-12)14(17)18/h1-8H |
| Molecular Formula | C12H8N2O4S2 |
| Molar Mass | 308.33 |
| Density | 1.5285 (rough estimate) |
| Melting Point | 181.0 to 186.0 °C |
| Boling Point | 478.8±30.0 °C(Predicted) |
| Flash Point | 243.4°C |
| Vapor Presure | 7.24E-09mmHg at 25°C |
| Appearance | Yellow or tan powder |
| Color | White to Yellow |
| Storage Condition | Sealed in dry,Room Temperature |
| Stability | Stable. Incompatible with strong oxidizing agents, strong bases. |
| Refractive Index | 1.6510 (estimate) |
| MDL | MFCD00003573 |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R40 - Limited evidence of a carcinogenic effect |
| Safety Description | 36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| RTECS | JO1550000 |
| HS Code | 29309090 |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| category | toxic substances |
| flammability hazard characteristics | thermal decomposition of toxic nitrogen oxides and sulfur oxide vapor |
| storage and transportation characteristics | ventilation, drying, sun protection |
| fire extinguishing agent | sand, water, foam and carbon dioxide |